2,2'-Naphthalene-2,6-diylidenedimalononitrile
Modify Date: 2025-08-26 14:57:49
2,2'-Naphthalene-2,6-diylidenedimalononitrile structure
|
Common Name | 2,2'-Naphthalene-2,6-diylidenedimalononitrile | ||
|---|---|---|---|---|
| CAS Number | 6251-01-0 | Molecular Weight | 254.246 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 311.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H6N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.4±21.8 °C | |
| Name | 2-[6-(dicyanomethylidene)naphthalen-2-ylidene]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.6±42.0 °C at 760 mmHg |
| Molecular Formula | C16H6N4 |
| Molecular Weight | 254.246 |
| Flash Point | 129.4±21.8 °C |
| Exact Mass | 254.059250 |
| PSA | 95.16000 |
| LogP | 0.28 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | JLTPSDHKZGWXTD-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=c1ccc2cc(=C(C#N)C#N)ccc2c1 |
|
~%
2,2'-Naphthalen... CAS#:6251-01-0 |
| Literature: Journal of Organic Chemistry, , vol. 28, p. 2719 - 2724 |
|
~%
2,2'-Naphthalen... CAS#:6251-01-0 |
| Literature: Journal of Organic Chemistry, , vol. 28, p. 2719 - 2724 |
|
~%
2,2'-Naphthalen... CAS#:6251-01-0 |
| Literature: Journal of Organic Chemistry, , vol. 28, p. 2719 - 2724 |
| 11,11,12,12-tetracyano-2,6-naphthoquinodimethan |
| 9,9,10,10-tetracyano-2,6-naphthoquinodimethane |
| 9,9,10,10-tetracyanonaphtho-2,6-quinodimethane |
| 11,11,12,12-Tetracyanonaphtho-2,6-quinodimethane |
| Tetracyano-2,6-naphthoquinodimethane |
| 11,11,12,12-tetracyano-2,6-naphthoquinodimethane |
| 2,2'-Naphthalene-2,6-diylidenedimalononitrile |
| 2,2'-(2,6-Naphthalenediylidene)dimalononitrile |
| TNAP |
| Propanedinitrile, 2,2'-(2,6-naphthalenediylidene)bis- |