1-Propanaminium,2-(acetyloxy)-N,N,N-trimethyl-, iodide (1:1)
Modify Date: 2025-09-14 12:10:16
1-Propanaminium,2-(acetyloxy)-N,N,N-trimethyl-, iodide (1:1) structure
|
Common Name | 1-Propanaminium,2-(acetyloxy)-N,N,N-trimethyl-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 625-19-4 | Molecular Weight | 287.13800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetyloxypropyl(trimethyl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H18INO2 |
|---|---|
| Molecular Weight | 287.13800 |
| Exact Mass | 287.03800 |
| PSA | 26.30000 |
| InChIKey | LCQWLOBDIMPRBS-UHFFFAOYSA-M |
| SMILES | CC(=O)OC(C)C[N+](C)(C)C.[I-] |
| HS Code | 2923900090 |
|---|
|
~%
1-Propanaminium... CAS#:625-19-4 |
| Literature: Alles; Hawes Journal of Biological Chemistry, 1940 , vol. 133, p. 381 |
|
~%
1-Propanaminium... CAS#:625-19-4 |
| Literature: Beckett,A.H. et al. Journal of Pharmacy and Pharmacology, 1963 , vol. 15, p. 349 - 361 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Mecholyl iodide |
| EINECS 210-879-4 |
| 2-Acetyl-1-dimethylamino-propan-methiodid |
| Methacholine iodide |
| 2-Acetoxypropyltrimethylammonium iodide |