5-bromo-2-methylbenzo[a]anthracene-7,12-dione
Modify Date: 2025-11-25 22:39:17
![5-bromo-2-methylbenzo[a]anthracene-7,12-dione Structure](https://image.chemsrc.com/caspic/227/62487-33-6.png)
5-bromo-2-methylbenzo[a]anthracene-7,12-dione structure
|
Common Name | 5-bromo-2-methylbenzo[a]anthracene-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 62487-33-6 | Molecular Weight | 351.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H11BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-2-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H11BrO2 |
|---|---|
| Molecular Weight | 351.19300 |
| Exact Mass | 349.99400 |
| PSA | 34.14000 |
| LogP | 4.68610 |
| InChIKey | FSOFAVSZCMPXFY-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(Br)cc3c(c2c1)C(=O)c1ccccc1C3=O |
|
~%
5-bromo-2-methy... CAS#:62487-33-6 |
| Literature: Otsuki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3713 - 3714 |
![2-(4-methylphenyl)benzo[f][1]benzofuran-4,9-dione structure](https://image.chemsrc.com/caspic/059/62452-64-6.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Brom-2-methylbenz<a>anthracen-7,12-dion |