2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid structure
|
Common Name | 2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 624722-10-7 | Molecular Weight | 218.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-2-(2-hydroxynaphthalen-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O4 |
|---|---|
| Molecular Weight | 218.20500 |
| Exact Mass | 218.05800 |
| PSA | 77.76000 |
| LogP | 1.66340 |
| InChIKey | KIJIBKVYISSOOB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)c1c(O)ccc2ccccc12 |
| HS Code | 2918199090 |
|---|
|
~%
2-hydroxy-2-(2-... CAS#:624722-10-7 |
| Literature: WO2012/140243 A1, ; Page/Page column 89 ; |
|
~%
2-hydroxy-2-(2-... CAS#:624722-10-7 |
| Literature: Synthesis, , # 3 p. 341 - 344 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hydroxyhydroxynaphthylaceticacid |