3,6-dibromo-2,2,7,7-tetramethyloct-4-yne structure
|
Common Name | 3,6-dibromo-2,2,7,7-tetramethyloct-4-yne | ||
|---|---|---|---|---|
| CAS Number | 62444-31-9 | Molecular Weight | 324.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dibromo-2,2,7,7-tetramethyloct-4-yne |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20Br2 |
|---|---|
| Molecular Weight | 324.09500 |
| Exact Mass | 321.99300 |
| LogP | 4.60900 |
| InChIKey | JBYWDRIHOFLHGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(Br)C#CC(Br)C(C)(C)C |
|
~%
3,6-dibromo-2,2... CAS#:62444-31-9 |
| Literature: Yamazaki,H. Journal of the Chemical Society, Chemical Communications, 1976 , # 21 p. 841 - 842 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6-dibromo-2,2,7,7-tetramethyl-oct-4-yne |
| 4-Octyne,3,6-dibromo-2,2,7,7-tetramethyl |
| 3,6-dibromo-2,2,7,7-tetramethyl-4-octyne |