N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline structure
|
Common Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 62441-54-7 | Molecular Weight | 429.65900 | |
| Density | 1.664g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C14H6ClF6N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | fentrifanil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C14H6ClF6N3O4 |
| Molecular Weight | 429.65900 |
| Flash Point | 179ºC |
| Exact Mass | 428.99500 |
| PSA | 103.67000 |
| LogP | 7.05700 |
| Index of Refraction | 1.56 |
| InChIKey | FVJQBZVCJVMBIP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2cc(C(F)(F)F)ccc2Cl)c(C(F)(F)F)c1 |
| HS Code | 2921440000 |
|---|
|
~%
N-[2-chloro-5-(... CAS#:62441-54-7 |
| Literature: Imperial Chemical Industries Limited Patent: US4128665 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)aniline |
| 2,5'-bistrifluoromethyl-2'-chloro-4,6-dinitrodiphenylamine |
| 2’-chloro-2,4-dinitro-5’,6-bis(trifluoromethyl)diphenylamine |
| N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitro-6-(trifluoromethyl)benzenamine |
| N-(6-chloro-α,α,α-trifluoro-m-tolyl)-α,α,α-trifluoro-4,6-dinitro-o-toluidine |
| hexafluoramin |