2-[[2-(2-methoxyphenoxy)acetyl]amino]propanoic acid
Modify Date: 2025-09-20 09:52:03
![2-[[2-(2-methoxyphenoxy)acetyl]amino]propanoic acid Structure](https://image.chemsrc.com/caspic/195/6240-94-4.png)
2-[[2-(2-methoxyphenoxy)acetyl]amino]propanoic acid structure
|
Common Name | 2-[[2-(2-methoxyphenoxy)acetyl]amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6240-94-4 | Molecular Weight | 253.25100 | |
| Density | 1.238g/cm3 | Boiling Point | 501.3ºC at 760 mmHg | |
| Molecular Formula | C12H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257ºC | |
| Name | 2-[[2-(2-methoxyphenoxy)acetyl]amino]propanoic acid |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 501.3ºC at 760 mmHg |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25100 |
| Flash Point | 257ºC |
| Exact Mass | 253.09500 |
| PSA | 88.35000 |
| LogP | 1.50360 |
| Index of Refraction | 1.531 |
| InChIKey | FPENGYPIIVADIX-UHFFFAOYSA-N |
| SMILES | COc1ccccc1OCC(=O)NC(C)C(=O)O |
|
~%
2-[[2-(2-methox... CAS#:6240-94-4 |
| Literature: Vogel,M.; Roberts,J.D. Journal of the American Chemical Society, 1966 , vol. 88, # 10 p. 2262 - 2271 |
|
~%
2-[[2-(2-methox... CAS#:6240-94-4 |
| Literature: Vogel,M.; Roberts,J.D. Journal of the American Chemical Society, 1966 , vol. 88, # 10 p. 2262 - 2271 |
