methyl 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoate
Modify Date: 2024-10-16 11:33:28
![methyl 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoate Structure](https://image.chemsrc.com/caspic/333/6240-59-1.png)
methyl 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoate structure
|
Common Name | methyl 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 6240-59-1 | Molecular Weight | 272.31900 | |
| Density | 1.253g/cm3 | Boiling Point | 434.6ºC at 760 mmHg | |
| Molecular Formula | C15H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | methyl 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760 mmHg |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.31900 |
| Flash Point | 216.7ºC |
| Exact Mass | 272.05100 |
| PSA | 71.61000 |
| LogP | 3.43080 |
| Index of Refraction | 1.629 |
| InChIKey | YQYYPDGJSXROOR-RMKNXTFCSA-N |
| SMILES | COC(=O)c1ccc(C=CC(=O)c2cccs2)cc1 |
|
~%
methyl 4-[(E)-3... CAS#:6240-59-1 |
| Literature: Ward,E.R.; Hardy,A. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1038 - 1040 |
| 1-Acetylamino-2-chlor-6-nitro-naphthalin |