propan-2-yl 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate structure
|
Common Name | propan-2-yl 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6237-87-2 | Molecular Weight | 262.30100 | |
| Density | 1.118g/cm3 | Boiling Point | 352.9ºC at 760 mmHg | |
| Molecular Formula | C15H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | propan-2-yl 5-ethoxy-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 352.9ºC at 760 mmHg |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30100 |
| Flash Point | 167.3ºC |
| Exact Mass | 262.12100 |
| PSA | 48.67000 |
| LogP | 3.70510 |
| Index of Refraction | 1.539 |
| InChIKey | VTQOICRVVFXBFJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2oc(C)c(C(=O)OC(C)C)c2c1 |
|
~%
propan-2-yl 5-e... CAS#:6237-87-2 |
| Literature: Loughran,G.A. et al. Journal of Heterocyclic Chemistry, 1966 , vol. 3, p. 143 - 148 |
| f0367-0022 |