4-TERT-BUTYL-1,3-DIHYDRO-IMIDAZOL-2-ONE structure
|
Common Name | 4-TERT-BUTYL-1,3-DIHYDRO-IMIDAZOL-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 623547-65-9 | Molecular Weight | 140.18300 | |
| Density | 1.04g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-1,3-dihydroimidazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.18300 |
| Exact Mass | 140.09500 |
| PSA | 48.65000 |
| LogP | 1.00050 |
| Index of Refraction | 1.482 |
| InChIKey | GGHBCYJQKCJGOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1c[nH]c(=O)[nH]1 |
| HS Code | 2933290090 |
|---|
|
~%
4-TERT-BUTYL-1,... CAS#:623547-65-9 |
| Literature: Chemische Berichte, , vol. 44, p. 2071 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-tert-butyl-1,3-dihydro-2H-imidazol-2-one |
| 4-tert-butyl-1,3-dihydro-imidazol-2-one |