3,4,4,5,5-pentafluoro-2-methoxycyclopent-2-en-1-one
Modify Date: 2025-08-25 16:14:57
3,4,4,5,5-pentafluoro-2-methoxycyclopent-2-en-1-one structure
|
Common Name | 3,4,4,5,5-pentafluoro-2-methoxycyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 62344-62-1 | Molecular Weight | 202.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4,4,5,5-pentafluoro-2-methoxycyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3F5O2 |
|---|---|
| Molecular Weight | 202.07900 |
| Exact Mass | 202.00500 |
| PSA | 26.30000 |
| LogP | 1.66720 |
| InChIKey | KTOLOOLMFMIGII-UHFFFAOYSA-N |
| SMILES | COC1=C(F)C(F)(F)C(F)(F)C1=O |
|
~%
3,4,4,5,5-penta... CAS#:62344-62-1 |
| Literature: Smart,B.E.; Krespan,C.G. Journal of the American Chemical Society, 1977 , vol. 99, p. 1218 - 1221 |
![4,4,5,5,6,6-hexafluoro-3a,6a-dimethoxy-tetrahydro-cyclopenta[1,3,2]dioxathiole 2,2-dioxide structure](https://image.chemsrc.com/caspic/302/62385-84-6.png)
| 2-Cyclopenten-1-one,3,4,4,5,5-pentafluoro-2-methoxy |
| 2-Methoxypentafluorcyclopent-2-en-1-on |
| 3,4,4,5,5-pentafluoro-2-methoxy-cyclopent-2-enone |