methyl 4-[(4-chlorophenyl)methoxy]benzoate structure
|
Common Name | methyl 4-[(4-chlorophenyl)methoxy]benzoate | ||
|---|---|---|---|---|
| CAS Number | 62290-46-4 | Molecular Weight | 276.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[(4-chlorophenyl)methoxy]benzoate |
|---|
| Molecular Formula | C15H13ClO3 |
|---|---|
| Molecular Weight | 276.71500 |
| Exact Mass | 276.05500 |
| PSA | 35.53000 |
| LogP | 3.70560 |
| InChIKey | IXQAIAXXKPYVGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCc2ccc(Cl)cc2)cc1 |
|
~%
methyl 4-[(4-ch... CAS#:62290-46-4 |
| Literature: Rastogi, Nisheeth; Harrison, Darwin Anil; Tripathi, Diwakar; Shukla, Sarveshwar Journal of the Indian Chemical Society, 2009 , vol. 86, # 9 p. 991 - 995 |