2-[hydroxy(phenyl)methyl]-2-trimethylsilyloxycyclobutan-1-one
Modify Date: 2025-11-24 20:30:18
![2-[hydroxy(phenyl)methyl]-2-trimethylsilyloxycyclobutan-1-one Structure](https://image.chemsrc.com/caspic/421/62248-59-3.png)
2-[hydroxy(phenyl)methyl]-2-trimethylsilyloxycyclobutan-1-one structure
|
Common Name | 2-[hydroxy(phenyl)methyl]-2-trimethylsilyloxycyclobutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 62248-59-3 | Molecular Weight | 264.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[hydroxy(phenyl)methyl]-2-trimethylsilyloxycyclobutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O3Si |
|---|---|
| Molecular Weight | 264.39200 |
| Exact Mass | 264.11800 |
| PSA | 46.53000 |
| LogP | 2.67320 |
| InChIKey | YNEZEHNEJFKGCP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1(C(O)c2ccccc2)CCC1=O |
|
~75%
2-[hydroxy(phen... CAS#:62248-59-3 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
| Cyclobutanone,2-(hydroxyphenylmethyl)-2-[(trimethylsilyl)oxy] |