2-bromo-1-(6-fluoronaphthalen-2-yl)ethanone
Modify Date: 2025-09-22 21:43:29
2-bromo-1-(6-fluoronaphthalen-2-yl)ethanone structure
|
Common Name | 2-bromo-1-(6-fluoronaphthalen-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 62244-79-5 | Molecular Weight | 267.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8BrFO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-1-(6-fluoronaphthalen-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8BrFO |
|---|---|
| Molecular Weight | 267.09400 |
| Exact Mass | 265.97400 |
| PSA | 17.07000 |
| LogP | 3.55650 |
| InChIKey | LJQDDHXBIOKJBI-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc2cc(F)ccc2c1 |
|
~79%
2-bromo-1-(6-fl... CAS#:62244-79-5 |
| Literature: Thirunarayanan; Vanangamudi; Sathiyendran; Ravi Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2011 , vol. 50, # 4 p. 593 - 604 |
| 6-Fluor-2-(bromacetyl)-naphthalin |
| Ethanone,2-bromo-1-(6-fluoro-2-naphthalenyl) |