3-Pyridinecarbonitrile,2-chloro-4,6-dimethyl-5-nitro-
Modify Date: 2025-09-24 10:05:21
3-Pyridinecarbonitrile,2-chloro-4,6-dimethyl-5-nitro- structure
|
Common Name | 3-Pyridinecarbonitrile,2-chloro-4,6-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6220-77-5 | Molecular Weight | 211.60500 | |
| Density | 1.42g/cm3 | Boiling Point | 340.4ºC at 760 mmHg | |
| Molecular Formula | C8H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6ºC | |
| Name | 2-chloro-4,6-dimethyl-5-nitropyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 340.4ºC at 760 mmHg |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.60500 |
| Flash Point | 159.6ºC |
| Exact Mass | 211.01500 |
| PSA | 82.50000 |
| LogP | 2.65488 |
| Index of Refraction | 1.578 |
| InChIKey | JVWPZCCMTFKYHN-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c(C#N)c(C)c1[N+](=O)[O-] |
|
~59%
3-Pyridinecarbo... CAS#:6220-77-5 |
| Literature: Dyadyuchenko; Strelkov; Mikhailichenko; Zaplishny Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 308 - 314 |
|
~%
3-Pyridinecarbo... CAS#:6220-77-5 |
| Literature: Dyadyuchenko; Strelkov; Mikhailichenko; Zaplishny Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 308 - 314 |
|
~%
3-Pyridinecarbo... CAS#:6220-77-5 |
| Literature: van Wagtendonk; Wibaut Recueil des Travaux Chimiques des Pays-Bas, 1942 , vol. 61, p. 728,731 |
CAS#:6972-36-7
CAS#:40548-90-1| 2-Chloro-4,6-dimethyl-5-nitro-nicotinonitrile |
| 2-chloro-5-nitro-3-cyano-4,6-dimethylpyridine |
| 2,4-dimethyl-3-nitro-5-cyano-6-chloropyridine |
| 2-chloro-3-cyano-4,6-dimethyl-5-nitropyridine |
| 2-Chlor-3-cyan-4,6-dimethyl-5-nitro-pyridin |
| BB_SC-0330 |
| 2-Chlor-4,6-dimethyl-5-nitro-nicotinonitril |
| 6-Chlor-5-cyano-2,4-dimethyl-3-nitro-pyridin |