6-(2-oxopropyl)-1H-pyrimidine-2,4-dione
Modify Date: 2025-09-20 17:57:58
6-(2-oxopropyl)-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-(2-oxopropyl)-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 62175-77-3 | Molecular Weight | 168.15000 | |
| Density | 1.254g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-oxopropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Exact Mass | 168.05300 |
| PSA | 82.79000 |
| Index of Refraction | 1.493 |
| InChIKey | DBUVTTNCNPGTOY-UHFFFAOYSA-N |
| SMILES | CC(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
|
~%
6-(2-oxopropyl)... CAS#:62175-77-3 |
| Literature: Bardagi, Javier I.; Rossi, Roberto A. Journal of Organic Chemistry, 2010 , vol. 75, # 15 p. 5271 - 5277 |
| Tetrahydro-1,2,3,4-dioxo-2,4-acetonyl-6-pyrimidin |
| 6-(2-oxo-propyl)-1H-pyrimidine-2,4-dione |
| 6-(2-oxopropyl)uracil |
| 6-(2-OXOPROPYL)-2,3H)-PYRIMIDINEDIONE |