8-Chloro-3a, 6-epoxy-1,2,3a, 6-tetrahydro-3-methyl-6-phenyl-3H-imidazo(1,2-a)(1,4)benzodiazepine-1,2-dione structure
|
Common Name | 8-Chloro-3a, 6-epoxy-1,2,3a, 6-tetrahydro-3-methyl-6-phenyl-3H-imidazo(1,2-a)(1,4)benzodiazepine-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 62167-11-7 | Molecular Weight | 353.75900 | |
| Density | 1.56g/cm3 | Boiling Point | 556.9ºC at 760 mmHg | |
| Molecular Formula | C18H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.6ºC | |
| Name | 8-chloro-3-methyl-6-phenyl-6H-3a,6-epioxido-benzo[f]imidazo[1,2-a][1,4]diazepine-1,2-dione |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 556.9ºC at 760 mmHg |
| Molecular Formula | C18H12ClN3O3 |
| Molecular Weight | 353.75900 |
| Flash Point | 290.6ºC |
| Exact Mass | 353.05700 |
| PSA | 62.21000 |
| LogP | 1.55300 |
| Index of Refraction | 1.751 |
| InChIKey | ARVGAFIPEMEJTK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=O)N2c3ccc(Cl)cc3C3(c4ccccc4)N=CC12O3 |
|
~%
8-Chloro-3a, 6-... CAS#:62167-11-7 |
| Literature: Fryer,R.I. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 2212 - 2219 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |