butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl prop-2-enoate
Modify Date: 2025-09-19 08:08:05
butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl prop-2-enoate structure
|
Common Name | butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 62151-90-0 | Molecular Weight | 315.36200 | |
| Density | N/A | Boiling Point | 145.9ºC at 760mmHg | |
| Molecular Formula | C15H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 39.4ºC | |
| Name | butyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,methyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 145.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.36200 |
| Flash Point | 39.4ºC |
| Exact Mass | 315.16800 |
| PSA | 105.42000 |
| LogP | 1.93980 |
| InChIKey | CHLZIHYUZDAZFQ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCO.C=CC(=O)OC.C=CC(=O)OCCCC |
| 2-Propenoic acid,butyl ester,polymer with N-(hydroxymethyl)-2-propenamide and methyl 2-propenoate |
| Butyl acrylate,methyl acrylate,N-methylolacrylamide polymer |