4-(3-bromoanilino)-4-oxobutanoic acid structure
|
Common Name | 4-(3-bromoanilino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 62134-50-3 | Molecular Weight | 272.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-bromoanilino)-4-oxobutanoic acid |
|---|
| Molecular Formula | C10H10BrNO3 |
|---|---|
| Molecular Weight | 272.09500 |
| Exact Mass | 270.98400 |
| PSA | 69.89000 |
| LogP | 2.90190 |
| InChIKey | AALXDJRXCDUOGA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1cccc(Br)c1 |
|
~%
4-(3-bromoanili... CAS#:62134-50-3 |
| Literature: Pressman; Bryden; Pauling Journal of the American Chemical Society, 1948 , vol. 70, p. 1354 |