4-methyl-N-[2-(4-nitrophenoxy)ethyl]aniline
Modify Date: 2025-09-24 11:45:31
![4-methyl-N-[2-(4-nitrophenoxy)ethyl]aniline Structure](https://image.chemsrc.com/caspic/258/62131-56-0.png)
4-methyl-N-[2-(4-nitrophenoxy)ethyl]aniline structure
|
Common Name | 4-methyl-N-[2-(4-nitrophenoxy)ethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 62131-56-0 | Molecular Weight | 272.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-[2-(4-nitrophenoxy)ethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16N2O3 |
|---|---|
| Molecular Weight | 272.29900 |
| Exact Mass | 272.11600 |
| PSA | 67.08000 |
| LogP | 3.99030 |
| InChIKey | UNPPCBIKMNZIIH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCCOc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
4-methyl-N-[2-(... CAS#:62131-56-0 |
| Literature: Knipe,A.C.; Lound-Keast,J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1741 - 1748 |
|
~%
4-methyl-N-[2-(... CAS#:62131-56-0 |
| Literature: Knipe,A.C.; Lound-Keast,J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1741 - 1748 |
![2-[(4-methylphenyl)amino]ethanol structure](https://image.chemsrc.com/caspic/400/2933-74-6.png)
| Benzenamine,4-methyl-N-[2-(4-nitrophenoxy)ethyl] |
| N-p-Tolyl-2-(p-nitrophenoxy)-ethylamin |