1-[1,1-bis(4-nitrophenyl)ethyl]-4-nitrobenzene
Modify Date: 2024-04-03 14:25:05
![1-[1,1-bis(4-nitrophenyl)ethyl]-4-nitrobenzene Structure](https://image.chemsrc.com/caspic/189/62122-57-0.png)
1-[1,1-bis(4-nitrophenyl)ethyl]-4-nitrobenzene structure
|
Common Name | 1-[1,1-bis(4-nitrophenyl)ethyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 62122-57-0 | Molecular Weight | 393.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[1,1-bis(4-nitrophenyl)ethyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H15N3O6 |
|---|---|
| Molecular Weight | 393.35000 |
| Exact Mass | 393.09600 |
| PSA | 137.46000 |
| LogP | 6.33510 |
| InChIKey | IDSYLKGBPDUPNO-UHFFFAOYSA-N |
| SMILES | CC(c1ccc([N+](=O)[O-])cc1)(c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~54%
1-[1,1-bis(4-ni... CAS#:62122-57-0 |
| Literature: Franke, Joachim; Voegtle, Fritz Angewandte Chemie, 1985 , vol. 97, # 3 p. 224 - 225 |
|
~%
1-[1,1-bis(4-ni... CAS#:62122-57-0 |
| Literature: Granzhan, Anton; Schouwey, Clement; Riis-Johannessen, Thomas; Scopelliti, Rosario; Severin, Kay Journal of the American Chemical Society, 2011 , vol. 133, # 18 p. 7106 - 7115 |
| 1,1,1-Tris-(4-nitro-phenyl)-aethan |
| Benzene,1,1',1''-ethylidynetris[4-nitro |
| 1,1,1-Tri(p-nitrophenyl)aethan |
| 1,1',1''-ethane-1,1,1-triyltris(4-nitrobenzene) |
| 1,1,1-tris(4-nitrophenyl)ethane |