4-methyl-7,8-bis(methylsulfonyloxy)chromen-2-one
Modify Date: 2025-10-20 09:28:52
4-methyl-7,8-bis(methylsulfonyloxy)chromen-2-one structure
|
Common Name | 4-methyl-7,8-bis(methylsulfonyloxy)chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 62113-97-7 | Molecular Weight | 348.34900 | |
| Density | 1.547g/cm3 | Boiling Point | 595.6ºC at 760 mmHg | |
| Molecular Formula | C12H12O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314ºC | |
| Name | (4-methyl-8-methylsulfonyloxy-2-oxochromen-7-yl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 595.6ºC at 760 mmHg |
| Molecular Formula | C12H12O8S2 |
| Molecular Weight | 348.34900 |
| Flash Point | 314ºC |
| Exact Mass | 347.99700 |
| PSA | 133.71000 |
| LogP | 2.93980 |
| Index of Refraction | 1.581 |
| InChIKey | LNUOVDYXSVMVOE-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2c(OS(C)(=O)=O)c(OS(C)(=O)=O)ccc12 |
|
~%
4-methyl-7,8-bi... CAS#:62113-97-7 |
| Literature: Desai; Parghi Journal of the Indian Chemical Society, 1956 , vol. 33, p. 483,486 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7,8-bis-methanesulfonyloxy-4-methyl-coumarin |
| 7,8-Bis-methansulfonyloxy-4-methyl-cumarin |
| 7,8-bis-methanesulfonyloxy-4-methyl-chromen-2-one |