(4-methyl-5-methylsulfonyloxy-2-oxochromen-7-yl) methanesulfonate
Modify Date: 2025-09-19 00:20:19
(4-methyl-5-methylsulfonyloxy-2-oxochromen-7-yl) methanesulfonate structure
|
Common Name | (4-methyl-5-methylsulfonyloxy-2-oxochromen-7-yl) methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 62113-96-6 | Molecular Weight | 348.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methyl-5-methylsulfonyloxy-2-oxochromen-7-yl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O8S2 |
|---|---|
| Molecular Weight | 348.34900 |
| Exact Mass | 347.99700 |
| PSA | 133.71000 |
| LogP | 2.93980 |
| InChIKey | OZONJJHADZTYFV-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(OS(C)(=O)=O)cc(OS(C)(=O)=O)c12 |
|
~%
(4-methyl-5-met... CAS#:62113-96-6 |
| Literature: Desai; Parghi Journal of the Indian Chemical Society, 1956 , vol. 33, p. 661,663 |
| 5,7-Bis-methansulfonyloxy-4-methyl-cumarin |
| 5,7-bis-methanesulfonyloxy-4-methyl-chromen-2-one |
| 5,7-bis-methanesulfonyloxy-4-methyl-coumarin |
| 2H-1-Benzopyran-2-one,4-methyl-5,7-bis[(methylsulfonyl)oxy] |