phenyl 2-(2-chlorophenoxy)acetate
Modify Date: 2025-08-22 19:32:48
phenyl 2-(2-chlorophenoxy)acetate structure
|
Common Name | phenyl 2-(2-chlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 62095-50-5 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl 2-(2-chlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 35.53000 |
| LogP | 3.32440 |
| InChIKey | JUUYZCCKKAMCFI-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccccc1Cl)Oc1ccccc1 |
|
~%
phenyl 2-(2-chl... CAS#:62095-50-5 |
| Literature: Hill; Towns; Senter Journal of the American Chemical Society, 1949 , vol. 71, p. 257 |
| Acetic acid,(2-chlorophenoxy)-,phenyl ester |