1-phenyl-2-(2,2,2-trichloro-1-hydroxyethyl)butane-1,3-dione
Modify Date: 2025-08-25 21:13:18
1-phenyl-2-(2,2,2-trichloro-1-hydroxyethyl)butane-1,3-dione structure
|
Common Name | 1-phenyl-2-(2,2,2-trichloro-1-hydroxyethyl)butane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62093-10-1 | Molecular Weight | 309.57300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-(2,2,2-trichloro-1-hydroxyethyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11Cl3O3 |
|---|---|
| Molecular Weight | 309.57300 |
| Exact Mass | 307.97700 |
| PSA | 54.37000 |
| LogP | 2.80560 |
| InChIKey | UQZSZCFUVAXTPL-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(=O)c1ccccc1)C(O)C(Cl)(Cl)Cl |
|
~%
1-phenyl-2-(2,2... CAS#:62093-10-1 |
| Literature: Uehara,K. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2817 - 2820 |
| 3-(1-Hydroxy-2,2,2-trichloraethyl)-4-phenyl-2,4-butandion |
| 1,3-Butanedione,1-phenyl-2-(2,2,2-trichloro-1-hydroxyethyl) |