methyl 3,6-dimethoxynaphthalene-2-carboxylate
Modify Date: 2025-10-15 12:06:33
methyl 3,6-dimethoxynaphthalene-2-carboxylate structure
|
Common Name | methyl 3,6-dimethoxynaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62055-54-3 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,6-dimethoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.25900 |
| Exact Mass | 246.08900 |
| PSA | 44.76000 |
| LogP | 2.64360 |
| InChIKey | XEBGZTBIIUOTEU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccc(OC)cc2cc1OC |
|
~%
methyl 3,6-dime... CAS#:62055-54-3 |
| Literature: Oommen,P.K. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, # 7 p. 1985 - 1988 |
| 2-Naphthalenecarboxylic acid,3,6-dimethoxy-,methyl ester |