trimethyl-[2-[[2-oxo-2-[2-(trimethylazaniumyl)ethylamino]acetyl]amino]ethyl]azanium,diiodide structure
|
Common Name | trimethyl-[2-[[2-oxo-2-[2-(trimethylazaniumyl)ethylamino]acetyl]amino]ethyl]azanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 62055-13-4 | Molecular Weight | 514.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H28I2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-[[2-oxo-2-[2-(trimethylazaniumyl)ethylamino]acetyl]amino]ethyl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H28I2N4O2 |
|---|---|
| Molecular Weight | 514.18500 |
| Exact Mass | 514.03000 |
| PSA | 70.84000 |
| LogP | 2.05320 |
| InChIKey | IQUJETVSSPGGHT-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCNC(=O)C(=O)NCC[N+](C)(C)C.[I-].[I-] |
|
~%
trimethyl-[2-[[... CAS#:62055-13-4 |
| Literature: Phillips Journal of the American Chemical Society, 1951 , vol. 73, p. 5822 |
| gc 41 |