3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide structure
|
Common Name | 3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 62054-43-7 | Molecular Weight | 260.10800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6BrNO2S |
|---|---|
| Molecular Weight | 260.10800 |
| Exact Mass | 258.93000 |
| PSA | 54.88000 |
| LogP | 2.08930 |
| InChIKey | VOFHJUGBYKSCFK-UHFFFAOYSA-N |
| SMILES | O=S1(=O)N=C(CBr)c2ccccc21 |
|
~%
3-(bromomethyl)... CAS#:62054-43-7 |
| Literature: Abramovitch,R.A. et al. Journal of the Chemical Society, Chemical Communications, 1976 , p. 771 - 772 |
| 1,2-Benzisothiazole,3-(bromomethyl)-,1,1-dioxide |