1-acetyl-3-chloro-5-methyl-5-thiophen-2-yl-imidazolidine-2,4-dione
Modify Date: 2025-09-01 13:05:06
1-acetyl-3-chloro-5-methyl-5-thiophen-2-yl-imidazolidine-2,4-dione structure
|
Common Name | 1-acetyl-3-chloro-5-methyl-5-thiophen-2-yl-imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 62032-00-2 | Molecular Weight | 272.70800 | |
| Density | 1.54g/cm3 | Boiling Point | 373.9ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.9ºC | |
| Name | 1-acetyl-3-chloro-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 373.9ºC at 760 mmHg |
| Molecular Formula | C10H9ClN2O3S |
| Molecular Weight | 272.70800 |
| Flash Point | 179.9ºC |
| Exact Mass | 272.00200 |
| PSA | 85.93000 |
| LogP | 1.80360 |
| Index of Refraction | 1.641 |
| InChIKey | QNGAUOFLDKLEBB-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)N(Cl)C(=O)C1(C)c1cccs1 |
|
~%
1-acetyl-3-chlo... CAS#:62032-00-2 |
| Literature: Rodgers,T.R. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 591 - 594 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-acetyl-3-chloro-5-methyl-5-(thiophen-2-yl)imidazolidine-2,4-dione |