4-methylphenyl ester of 2-chloro-selenonicotin acid
Modify Date: 2025-10-10 11:49:26
4-methylphenyl ester of 2-chloro-selenonicotin acid structure
|
Common Name | 4-methylphenyl ester of 2-chloro-selenonicotin acid | ||
|---|---|---|---|---|
| CAS Number | 62029-64-5 | Molecular Weight | 310.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNOSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylphenyl ester of 2-chloro-selenonicotin acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClNOSe |
|---|---|
| Molecular Weight | 310.63800 |
| Exact Mass | 310.96200 |
| PSA | 29.96000 |
| LogP | 2.21330 |
| InChIKey | RXLKSOHIRWIMQN-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Se]C(=O)c2cccnc2Cl)cc1 |
| 2-Chlor-selenonicotinsaeure-Se-p-tolylester |
| 2-chloro-selenonicotinic acid Se-p-tolyl ester |