methyl 2-hydroxy-3-methyl-3-nitrobutanoate structure
|
Common Name | methyl 2-hydroxy-3-methyl-3-nitrobutanoate | ||
|---|---|---|---|---|
| CAS Number | 62000-54-8 | Molecular Weight | 177.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-hydroxy-3-methyl-3-nitrobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11NO5 |
|---|---|
| Molecular Weight | 177.15500 |
| Exact Mass | 177.06400 |
| PSA | 92.35000 |
| LogP | 0.09880 |
| InChIKey | SLNQMKAQWMDDHU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)C(C)(C)[N+](=O)[O-] |
|
~%
methyl 2-hydrox... CAS#:62000-54-8 |
| Literature: Kaji,E. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3181 - 3184 |
| Butanoic acid,2-hydroxy-3-methyl-3-nitro-,methyl ester |