2-Propenamide,2-cyano-3-(1-naphthalenyl)- structure
|
Common Name | 2-Propenamide,2-cyano-3-(1-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 61906-75-0 | Molecular Weight | 222.24200 | |
| Density | 1.269g/cm3 | Boiling Point | 505.1ºC at 760mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.3ºC | |
| Name | (2S)-2-(4-amino-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 505.1ºC at 760mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24200 |
| Flash Point | 259.3ºC |
| Exact Mass | 222.07900 |
| PSA | 66.88000 |
| LogP | 2.93238 |
| Index of Refraction | 1.703 |
| InChIKey | AVMHTBJNERNMNF-XYOKQWHBSA-N |
| SMILES | N#CC(=Cc1cccc2ccccc12)C(N)=O |
| HS Code | 2926909090 |
|---|
|
~80%
2-Propenamide,2... CAS#:61906-75-0 |
| Literature: Gazit, Aviv; App, Harald; McMahon, Gerald; Chen, Jefferey; Levitzki, Alexander; Bohmer, Frank D. Journal of Medicinal Chemistry, 1996 , vol. 39, # 11 p. 2170 - 2177 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |