4-(3,4-dimethoxyphenyl)but-1-en-2-yloxy-trimethylsilane
Modify Date: 2025-09-26 14:59:43
4-(3,4-dimethoxyphenyl)but-1-en-2-yloxy-trimethylsilane structure
|
Common Name | 4-(3,4-dimethoxyphenyl)but-1-en-2-yloxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 61871-73-6 | Molecular Weight | 280.43500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-dimethoxyphenyl)but-1-en-2-yloxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O3Si |
|---|---|
| Molecular Weight | 280.43500 |
| Exact Mass | 280.14900 |
| PSA | 27.69000 |
| LogP | 4.00160 |
| InChIKey | VZRVXYNZJBRKSH-UHFFFAOYSA-N |
| SMILES | C=C(CCc1ccc(OC)c(OC)c1)O[Si](C)(C)C |
|
~%
4-(3,4-dimethox... CAS#:61871-73-6 |
| Literature: Dennif, Phillip; Macleod, Ian; Whiting, Donald A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 82 - 87 |
| methylzingerone trimethylsilyl ether |
| Silane,[3-(3,4-dimethoxyphenyl)-1-methylenepropoxy]trimethyl |