5,5-dimethyl-6-nitrohexan-3-one structure
|
Common Name | 5,5-dimethyl-6-nitrohexan-3-one | ||
|---|---|---|---|---|
| CAS Number | 61856-73-3 | Molecular Weight | 173.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-dimethyl-6-nitrohexan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15NO3 |
|---|---|
| Molecular Weight | 173.21000 |
| Exact Mass | 173.10500 |
| PSA | 62.89000 |
| LogP | 2.18170 |
| InChIKey | BMOMKSWVSQUXQP-UHFFFAOYSA-N |
| SMILES | CCC(=O)CC(C)(C)C[N+](=O)[O-] |
|
~%
5,5-dimethyl-6-... CAS#:61856-73-3 |
| Literature: C Black,D.S. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1951 - 1954 |
| 3-Hexanone,5,5-dimethyl-6-nitro |
| 5,5-dimethyl-6-nitro-hexan-3-one |