1,2,4-trimethyl-5-(2,4,5-trimethylphenyl)sulfanylbenzene
Modify Date: 2025-09-10 19:09:42
1,2,4-trimethyl-5-(2,4,5-trimethylphenyl)sulfanylbenzene structure
|
Common Name | 1,2,4-trimethyl-5-(2,4,5-trimethylphenyl)sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61841-56-3 | Molecular Weight | 270.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,4-trimethyl-5-(2,4,5-trimethylphenyl)sulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22S |
|---|---|
| Molecular Weight | 270.43200 |
| Exact Mass | 270.14400 |
| PSA | 25.30000 |
| LogP | 5.68820 |
| InChIKey | OMDSMWAFALQVII-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Sc2cc(C)c(C)cc2C)cc1C |
|
~%
1,2,4-trimethyl... CAS#:61841-56-3 |
| Literature: Cohen; Skirrow Journal of the Chemical Society, 1899 , vol. 75, p. 890 |
| Dipseudocumylsulfid |
| bis-(2,4,5-trimethyl-phenyl)-sulfide |
| Benzene,1,1'-thiobis[2,4,5-trimethyl |