(5-AMINO-1-PHENYL-1H-PYRAZOL-4-YL)(4-BROMOPHENYL)METHANONE structure
|
Common Name | (5-AMINO-1-PHENYL-1H-PYRAZOL-4-YL)(4-BROMOPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 618091-10-4 | Molecular Weight | 342.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-amino-1-phenylpyrazol-4-yl)-(4-bromophenyl)methanone |
|---|
| Molecular Formula | C16H12BrN3O |
|---|---|
| Molecular Weight | 342.19000 |
| Exact Mass | 341.01600 |
| PSA | 60.91000 |
| LogP | 4.02920 |
| InChIKey | MZSMYXDQQXFWEF-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)c2ccc(Br)cc2)cnn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
|
~61%
(5-AMINO-1-PHEN... CAS#:618091-10-4 |
| Literature: Toche; Kazi; Jachak Organic Preparations and Procedures International, 2008 , vol. 40, # 6 p. 551 - 561 |
|
~%
(5-AMINO-1-PHEN... CAS#:618091-10-4 |
| Literature: Grothaus; Dains Journal of the American Chemical Society, 1936 , vol. 58, p. 1334 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |