ethyl 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate
Modify Date: 2025-12-02 09:03:38
ethyl 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate structure
|
Common Name | ethyl 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 618070-60-3 | Molecular Weight | 363.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-(4-bromophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|
| Molecular Formula | C13H10BrF3N2O2 |
|---|---|
| Molecular Weight | 363.13000 |
| Exact Mass | 361.98800 |
| PSA | 44.12000 |
| LogP | 3.83030 |
| InChIKey | NAJXKKJESQTFBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccc(Br)cc2)c1C(F)(F)F |
| HS Code | 2933199090 |
|---|
|
~89%
ethyl 1-(4-brom... CAS#:618070-60-3 |
| Literature: Obermayer, David; Glasnov, Toma N.; Kappe, C. Oliver Journal of Organic Chemistry, 2011 , vol. 76, # 16 p. 6657 - 6669 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |