2,2',3,3',4,6-Hexachlorobiphenyl structure
|
Common Name | 2,2',3,3',4,6-Hexachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 61798-70-7 | Molecular Weight | 360.87800 | |
| Density | 1.593g/cm3 | Boiling Point | 386.4ºC at 760mmHg | |
| Molecular Formula | C12H4Cl6 | Melting Point | 115.76°C (estimate) | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | 2,2',3,3',4,6-Hexachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 386.4ºC at 760mmHg |
| Melting Point | 115.76°C (estimate) |
| Molecular Formula | C12H4Cl6 |
| Molecular Weight | 360.87800 |
| Flash Point | 185.9ºC |
| Exact Mass | 357.84400 |
| LogP | 7.27400 |
| Index of Refraction | 1.626 |
| InChIKey | WDLTVNWWEZJMPF-UHFFFAOYSA-N |
| SMILES | Clc1cccc(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c1Cl |
| HS Code | 2903999090 |
|---|
|
~%
2,2',3,3',4,6-H... CAS#:61798-70-7 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3,5-tetrachloro-4-(2,3-dichlorophenyl)benzene |