1-benzylpiperidine,perchloric acid
Modify Date: 2025-09-26 17:16:19
1-benzylpiperidine,perchloric acid structure
|
Common Name | 1-benzylpiperidine,perchloric acid | ||
|---|---|---|---|---|
| CAS Number | 61777-45-5 | Molecular Weight | 275.72900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzylpiperidine,perchloric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18ClNO4 |
|---|---|
| Molecular Weight | 275.72900 |
| Exact Mass | 275.09200 |
| PSA | 74.68000 |
| LogP | 2.76670 |
| InChIKey | CGEUDYKGBRWFHL-UHFFFAOYSA-N |
| SMILES | [O-][Cl+3]([O-])([O-])O.c1ccc(CN2CCCCC2)cc1 |
|
~85%
1-benzylpiperid... CAS#:61777-45-5 |
| Literature: Katritzky, Alan R.; Thind, Sukhpal S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1895 - 1900 |
| Piperidine,1-(phenylmethyl)-,perchlorate |