9-azido-9-phenylthioxanthene structure
|
Common Name | 9-azido-9-phenylthioxanthene | ||
|---|---|---|---|---|
| CAS Number | 61744-34-1 | Molecular Weight | 315.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-azido-9-phenylthioxanthene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13N3S |
|---|---|
| Molecular Weight | 315.39200 |
| Exact Mass | 315.08300 |
| PSA | 75.05000 |
| LogP | 5.20616 |
| InChIKey | VFIWLOWQLXSBEV-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1(c2ccccc2)c2ccccc2Sc2ccccc21 |
|
~%
9-azido-9-pheny... CAS#:61744-34-1 |
| Literature: Coombs Journal of the Chemical Society, 1958 , p. 4200 |
| 9H-Thioxanthene,9-azido-9-phenyl |
| 9-azido-9-phenyl-thioxanthene |