2,6-dimethylhept-1-en-3-ylsulfanylbenzene structure
|
Common Name | 2,6-dimethylhept-1-en-3-ylsulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61737-13-1 | Molecular Weight | 234.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethylhept-1-en-3-ylsulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22S |
|---|---|
| Molecular Weight | 234.40000 |
| Exact Mass | 234.14400 |
| PSA | 25.30000 |
| LogP | 5.15960 |
| InChIKey | XLZHGSGVESFDGU-UHFFFAOYSA-N |
| SMILES | C=C(C)C(CCC(C)C)Sc1ccccc1 |
|
~%
2,6-dimethylhep... CAS#:61737-13-1 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |
|
~%
2,6-dimethylhep... CAS#:61737-13-1 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |
|
~%
2,6-dimethylhep... CAS#:61737-13-1 |
| Literature: Brownbridge,P.; Warren,S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1131 - 1141 |
| Benzene,[[4-methyl-1-(1-methylethenyl)pentyl]thio] |