6-(4-fluorophenyl)-1,3-oxazine-2,4-dione
Modify Date: 2025-09-21 15:58:26
6-(4-fluorophenyl)-1,3-oxazine-2,4-dione structure
|
Common Name | 6-(4-fluorophenyl)-1,3-oxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61736-38-7 | Molecular Weight | 207.15800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-fluorophenyl)-1,3-oxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6FNO3 |
|---|---|
| Molecular Weight | 207.15800 |
| Exact Mass | 207.03300 |
| PSA | 63.33000 |
| LogP | 1.54650 |
| InChIKey | FOXYQGXLTIFFCA-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(F)cc2)oc(=O)[nH]1 |
|
~%
6-(4-fluorophen... CAS#:61736-38-7 |
| Literature: Ahmed,S. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1969 - 1975 |
| 2H-1,3-Oxazine-2,4(3H)-dione,6-(4-fluorophenyl) |
| 6-(4-Fluor-phenyl)-1,3-oxazin-2,4(3H)-dion |
| 6-(4-fluoro-phenyl)-[1,3]oxazine-2,4-dione |