Benzoic acid,2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-5-nitro-
Modify Date: 2024-01-10 21:07:44
![Benzoic acid,2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-5-nitro- Structure](https://image.chemsrc.com/caspic/474/61708-31-4.png)
Benzoic acid,2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-5-nitro- structure
|
Common Name | Benzoic acid,2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 61708-31-4 | Molecular Weight | 340.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-methyl-3-(trifluoromethyl)anilino]-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11F3N2O4 |
|---|---|
| Molecular Weight | 340.25400 |
| Exact Mass | 340.06700 |
| PSA | 95.15000 |
| LogP | 4.96000 |
| InChIKey | SOWDTHRIACEPGB-UHFFFAOYSA-N |
| SMILES | Cc1c(Nc2ccc([N+](=O)[O-])cc2C(=O)O)cccc1C(F)(F)F |
| HS Code | 2922499990 |
|---|
|
~%
Benzoic acid,2-... CAS#:61708-31-4 |
| Literature: Schering Corporation Patent: US4029815 A1, 1977 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 5-nitro-N-(2-methyl-3-trifluoromethylphenyl) anthranilic acid |
| Benzoic acid,2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-5-nitro |