2-Propyn-1-yl 4-methylbenzenesulfonate structure
|
Common Name | 2-Propyn-1-yl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 6165-76-0 | Molecular Weight | 210.250 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 345.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 163.0±20.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Propargyl p-toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.8±17.0 °C at 760 mmHg |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.250 |
| Flash Point | 163.0±20.9 °C |
| Exact Mass | 210.035065 |
| PSA | 51.75000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | LMBVCSFXFFROTA-UHFFFAOYSA-N |
| SMILES | C#CCOS(=O)(=O)c1ccc(C)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate. Not miscible in water. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | XT7300000 |
| HS Code | 2905290000 |
|
~93%
2-Propyn-1-yl 4... CAS#:6165-76-0 |
| Literature: Srinivasan, Rajavel; Uttamchandani, Mahesh; Yao, Shao Q. Organic Letters, 2006 , vol. 8, # 4 p. 713 - 716 |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Functional activation of G-proteins coupled with muscarinic acetylcholine receptors in rat brain membranes.
J. Pharmacol. Sci. 125(2) , 157-68, (2014) The functional activation of Gi/o proteins coupled to muscarinic acetylcholine receptors (mAChRs) was investigated with the conventional guanosine-5'-O-(3-[(35)S]thio) triphosphate ([(35)S]GTPγS) bind... |
| MFCD00078365 |
| 2-Propyn-1-ol, 4-methylbenzenesulfonate |
| prop-2-ynyl 4-methylbenzenesulfonate |
| 2-Propyn-1-yl 4-methylbenzenesulfonate |
| Prop-2-yn-1-yl 4-methylbenzenesulfonate |