CHEMBRDG-BB 5689234 structure
|
Common Name | CHEMBRDG-BB 5689234 | ||
|---|---|---|---|---|
| CAS Number | 61640-16-2 | Molecular Weight | 247.72000 | |
| Density | 1.191g/cm3 | Boiling Point | 364ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 174ºC | |
| Name | 4-(4-chloro-2-methylquinolin-3-yl)butan-2-one |
|---|
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 364ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72000 |
| Flash Point | 174ºC |
| Exact Mass | 247.07600 |
| PSA | 29.96000 |
| LogP | 3.71820 |
| Index of Refraction | 1.595 |
| InChIKey | RJNCBNFDDJUWAS-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1c(C)nc2ccccc2c1Cl |
|
~82%
CHEMBRDG-BB 5689234 CAS#:61640-16-2 |
| Literature: Kadzimirsz, Daniel; Kramer, Daniel; Sripanom, Lertnarong; Oppel, Iris M.; Rodziewicz, Pawel; Doltsinis, Nikos L.; Dyker, Gerald Journal of Organic Chemistry, 2008 , vol. 73, # 12 p. 4644 - 4649 |