8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, exo-, compd. with 2,4, 6-trinitrophenol (1:1) structure
|
Common Name | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, exo-, compd. with 2,4, 6-trinitrophenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6164-68-7 | Molecular Weight | 370.31500 | |
| Density | N/A | Boiling Point | 303.6ºC at 760mmHg | |
| Molecular Formula | C14H18N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-ol,2,4,6-trinitrophenol |
|---|
| Boiling Point | 303.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H18N4O8 |
| Molecular Weight | 370.31500 |
| Flash Point | 133.9ºC |
| Exact Mass | 370.11200 |
| PSA | 181.16000 |
| LogP | 3.22820 |
| InChIKey | HFBUEWDSKZLEFF-UHFFFAOYSA-N |
| SMILES | CN1C2CCC1CC(O)C2.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |