(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one,(2R,3R)-2,3-dihydroxybutanedioic acid,2-[4-(2-methylpropyl)phenyl]propanoic acid structure
|
Common Name | (4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one,(2R,3R)-2,3-dihydroxybutanedioic acid,2-[4-(2-methylpropyl)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 615580-69-3 | Molecular Weight | 655.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H45NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4R,4aR,7aR,12bS)-9-methoxy-3-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one,(2R,3R)-2,3-dihydroxybutanedioic acid,2-[4-(2-methylpropyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C35H45NO11 |
|---|---|
| Molecular Weight | 655.73200 |
| Exact Mass | 655.29900 |
| PSA | 191.13000 |
| LogP | 2.82180 |
| InChIKey | OPEYVVLXBYHKDO-DANDVKJOSA-N |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O)cc1.COc1ccc2c3c1OC1C(=O)CCC4C(C2)N(C)CCC314.O=C(O)C(O)C(O)C(=O)O |
| IBUDONE |
| Hydrocodone bitartrate-ibuprofen mixt |
| Hydrocodone and Ibuprofen |
| Hydrocodone mixture with ibuprofen |
| Hydrocodone tartrate mixture with ibuprofen |
| Reprexain |