(4E)-4-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,5-tetrol structure
|
Common Name | (4E)-4-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,5-tetrol | ||
|---|---|---|---|---|
| CAS Number | 6155-41-5 | Molecular Weight | 285.25300 | |
| Density | 1.54g/cm3 | Boiling Point | 607.9ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 321.5ºC | |
| Name | (4E)-4-[(2-nitrophenyl)hydrazinylidene]pentane-1,2,3,5-tetrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 607.9ºC at 760 mmHg |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.25300 |
| Flash Point | 321.5ºC |
| Exact Mass | 285.09600 |
| PSA | 151.13000 |
| Index of Refraction | 1.629 |
| InChIKey | BXKCHSGKQBDYBI-CHHQANOXSA-N |
| SMILES | O=[N+]([O-])c1ccccc1NN=C(CO)C(O)C(O)CO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| D-Ribulose o-nitrophenylhydrazone |