1-chloro-4,7-dihydroxy-5-methoxy-2-methylanthracene-9,10-dione
Modify Date: 2025-10-14 18:46:48
1-chloro-4,7-dihydroxy-5-methoxy-2-methylanthracene-9,10-dione structure
|
Common Name | 1-chloro-4,7-dihydroxy-5-methoxy-2-methylanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 61539-64-8 | Molecular Weight | 318.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4,7-dihydroxy-5-methoxy-2-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11ClO5 |
|---|---|
| Molecular Weight | 318.70900 |
| Exact Mass | 318.03000 |
| PSA | 83.83000 |
| LogP | 2.84360 |
| InChIKey | WTKUUVJCYQHQEI-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cc(C)c(Cl)c1C2=O |
|
~%
1-chloro-4,7-di... CAS#:61539-64-8 |
| Literature: Banville,J.; Brassard,P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1852 - 1856 |
| 9,10-Anthracenedione,1-chloro-4,7-dihydroxy-5-methoxy-2-methyl |
| 4-Chlor-1,6-dihydroxy-8-methoxy-3-methylanthraquinon |