2-[2-[carboxymethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]acetic acid structure
|
Common Name | 2-[2-[carboxymethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 61533-59-3 | Molecular Weight | 374.43300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[carboxymethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]acetic acid |
|---|
| Molecular Formula | C16H30N4O6 |
|---|---|
| Molecular Weight | 374.43300 |
| Exact Mass | 374.21700 |
| PSA | 146.26000 |
| LogP | 0.49260 |
| InChIKey | MPCUEXFZOHFQIN-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)CN(CCN(CC(=O)O)CC(=O)NCCC)CC(=O)O |
|
~67%
2-[2-[carboxyme... CAS#:61533-59-3 |
| Literature: Platas-Iglesias, Carlos; Corsi, Daniele M.; Vander Elst, Luce; Muller, Robert N.; Imbert, Daniel; Buenzli, Jean-Claude G.; Toth, Eva; Maschmeyer, Thomas; Peters, Joop A. Journal of the Chemical Society. Dalton Transactions, 2003 , # 4 p. 727 - 737 |